![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 10 Breeding Processes and Nuclear Energy Systems of Generation IV.pdf | 2019-04-16 16:53 | 1.6M | |
| 01 Fission and Fusion.pdf | 2019-04-16 16:53 | 903K | |
| 04 Flux, cross-sec, chain reaction, criticality, moderation.pdf | 2019-04-16 16:53 | 769K | |
| 03 Radiodecay, fission, fast and thermal, fissile and fertile.pdf | 2019-04-16 16:53 | 756K | |
| 08 Light Water Reactors.pdf | 2019-04-16 16:53 | 532K | |
| 02 Nuclear energy, enrichment.pdf | 2019-04-16 16:53 | 501K | |
| 07 1G and 2G theories.pdf | 2019-04-16 16:53 | 457K | |
| 09 Reactor Safety.pdf | 2019-04-16 16:53 | 365K | |
| 05 Reactor dynamics.pdf | 2019-04-16 16:53 | 322K | |
| 06 Transport and diffusion equations for neutron flux distribution.pdf | 2019-04-16 16:53 | 195K | |
| ExampleWrittenExamNPandRT.pdf | 2019-04-16 16:53 | 18K | |